C26H10F2N4O2 — CID 59348090
8,22-difluoro-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione (PubChem CID 59348090) has the molecular formula C26H10F2N4O2 and a molecular weight of 448.39 g/mol. Its IUPAC name is 8,22-difluoro-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione.
| Compound Name | 8,22-difluoro-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione |
|---|---|
| PubChem CID | 59348090 |
| Molecular Formula | C26H10F2N4O2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 8,22-difluoro-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione |
| SMILES | O=c1c2ccc3c4c(ccc(c24)c2nc4cccc(F)c4n12)c(=O)n1c3nc2cccc(F)c21 |
| InChI | InChI=1S/C26H10F2N4O2/c27-15-3-1-5-17-21(15)31-23(29-17)11-7-9-14-20-12(8-10-13(19(11)20)25(31)33)24-30-18-6-2-4-16(28)22(18)32(24)26(14)34/h1-10H |
| InChIKey | KWPMJHSEWBTKPI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|