C11H30N2O6PSi+ — CID 59350055
2-[2-[[dimethoxy(methyl)silyl]methylamino]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59350055) has the molecular formula C11H30N2O6PSi+ and a molecular weight of 345.43 g/mol. Its IUPAC name is 2-[2-[[dimethoxy(methyl)silyl]methylamino]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[[dimethoxy(methyl)silyl]methylamino]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59350055 |
| Molecular Formula | C11H30N2O6PSi+ |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[2-[[dimethoxy(methyl)silyl]methylamino]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CO[Si](C)(CNCCOP(=O)(O)OCC[N+](C)(C)C)OC |
| InChI | InChI=1S/C11H29N2O6PSi/c1-13(2,3)8-10-19-20(14,15)18-9-7-12-11-21(6,16-4)17-5/h12H,7-11H2,1-6H3/p+1 |
| InChIKey | YXKVSRFODQHSEA-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|