C13H34N2O7PSi+ — CID 11646761
2-[hydroxy-[2-(3-trimethoxysilylpropylamino)ethoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 11646761) has the molecular formula C13H34N2O7PSi+ and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[hydroxy-[2-(3-trimethoxysilylpropylamino)ethoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-(3-trimethoxysilylpropylamino)ethoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 11646761 |
| Molecular Formula | C13H34N2O7PSi+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[hydroxy-[2-(3-trimethoxysilylpropylamino)ethoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CO[Si](CCCNCCOP(=O)(O)OCC[N+](C)(C)C)(OC)OC |
| InChI | InChI=1S/C13H33N2O7PSi/c1-15(2,3)10-12-22-23(16,17)21-11-9-14-8-7-13-24(18-4,19-5)20-6/h14H,7-13H2,1-6H3/p+1 |
| InChIKey | JLFHOMSHCMVSCT-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|