C13H30NO9PSi — CID 11697048
[2-oxo-2-(3-trimethoxysilylpropoxy)ethyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 11697048) has the molecular formula C13H30NO9PSi and a molecular weight of 403.44 g/mol. Its IUPAC name is [2-oxo-2-(3-trimethoxysilylpropoxy)ethyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-oxo-2-(3-trimethoxysilylpropoxy)ethyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 11697048 |
| Molecular Formula | C13H30NO9PSi |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [2-oxo-2-(3-trimethoxysilylpropoxy)ethyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CO[Si](CCCOC(=O)COP(=O)([O-])OCC[N+](C)(C)C)(OC)OC |
| InChI | InChI=1S/C13H30NO9PSi/c1-14(2,3)8-10-22-24(16,17)23-12-13(15)21-9-7-11-25(18-4,19-5)20-6/h7-12H2,1-6H3 |
| InChIKey | IXKRYOKYIKLJDV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|