C32H25F3N2O4S2 — CID 59351822
[7-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethyl-6-oxo-5-(2-phenylethyl)thieno[2,3-b]pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 59351822) has the molecular formula C32H25F3N2O4S2 and a molecular weight of 622.69 g/mol. Its IUPAC name is [7-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethyl-6-oxo-5-(2-phenylethyl)thieno[2,3-b]pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [7-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethyl-6-oxo-5-(2-phenylethyl)thieno[2,3-b]pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59351822 |
| Molecular Formula | C32H25F3N2O4S2 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | [7-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethyl-6-oxo-5-(2-phenylethyl)thieno[2,3-b]pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | CCc1cc2c(OS(=O)(=O)C(F)(F)F)c(CCc3ccccc3)c(=O)n(Cc3ccc(-c4ccccc4C#N)cc3)c2s1 |
| InChI | InChI=1S/C32H25F3N2O4S2/c1-2-25-18-28-29(41-43(39,40)32(33,34)35)27(17-14-21-8-4-3-5-9-21)30(38)37(31(28)42-25)20-22-12-15-23(16-13-22)26-11-7-6-10-24(26)19-36/h3-13,15-16,18H,2,14,17,20H2,1H3 |
| InChIKey | XSMCHOSRTKTGKY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 89.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|