C18H19N5O3S — CID 59352819
1-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea (PubChem CID 59352819) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 1-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea.
| Compound Name | 1-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 59352819 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1nc2cc(-c3cccnc3)c(OCCOC)nc2s1 |
| InChI | InChI=1S/C18H19N5O3S/c1-3-6-20-17(24)23-18-21-14-10-13(12-5-4-7-19-11-12)15(22-16(14)27-18)26-9-8-25-2/h3-5,7,10-11H,1,6,8-9H2,2H3,(H2,20,21,23,24) |
| InChIKey | UGAWLNGDQSYNDJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|