C17H19N5O3S — CID 59352825
1-ethyl-3-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea (PubChem CID 59352825) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is 1-ethyl-3-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea.
| Compound Name | 1-ethyl-3-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea |
|---|---|
| PubChem CID | 59352825 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-ethyl-3-[5-(2-methoxyethoxy)-6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2cc(-c3cccnc3)c(OCCOC)nc2s1 |
| InChI | InChI=1S/C17H19N5O3S/c1-3-19-16(23)22-17-20-13-9-12(11-5-4-6-18-10-11)14(21-15(13)26-17)25-8-7-24-2/h4-6,9-10H,3,7-8H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | BPIAZJYUGZZIFG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|