C30H21IrN2- — CID 59358558
3-benzyl-7-(4-ethenylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 59358558) has the molecular formula C30H21IrN2- and a molecular weight of 601.73 g/mol. Its IUPAC name is 3-benzyl-7-(4-ethenylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 3-benzyl-7-(4-ethenylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 59358558 |
| Molecular Formula | C30H21IrN2- |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 3-benzyl-7-(4-ethenylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | C=Cc1ccc(-c2ccc3c(c2)c2ccc[c-]c2c2ncc(Cc4ccccc4)n32)cc1.[Ir] |
| InChI | InChI=1S/C30H21N2.Ir/c1-2-21-12-14-23(15-13-21)24-16-17-29-28(19-24)26-10-6-7-11-27(26)30-31-20-25(32(29)30)18-22-8-4-3-5-9-22;/h2-10,12-17,19-20H,1,18H2;/q-1; |
| InChIKey | UTUBIZLHKKVFLK-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|