C22H30N6O2S — CID 59359787
4-amino-2-(4-hydroxybutylsulfanyl)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one (PubChem CID 59359787) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-amino-2-(4-hydroxybutylsulfanyl)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-(4-hydroxybutylsulfanyl)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 59359787 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 4-amino-2-(4-hydroxybutylsulfanyl)-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
| SMILES | Nc1nc(SCCCCO)nc2c1NC(=O)CN2Cc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C22H30N6O2S/c23-20-19-21(26-22(25-20)31-11-4-3-10-29)28(15-18(30)24-19)14-17-7-5-6-16(12-17)13-27-8-1-2-9-27/h5-7,12,29H,1-4,8-11,13-15H2,(H,24,30)(H2,23,25,26) |
| InChIKey | GMPIMCHFSDSTBV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|