C32H36N4O6 — CID 59365010
4-[[2-[[(2S)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]propanoyl]amino]-3-methylbutanoyl]amino]benzoic acid (PubChem CID 59365010) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-[[2-[[(2S)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]propanoyl]amino]-3-methylbutanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[(2S)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]propanoyl]amino]-3-methylbutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59365010 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 4-[[2-[[(2S)-2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]propanoyl]amino]-3-methylbutanoyl]amino]benzoic acid |
| SMILES | CC(C)C(NC(=O)[C@H](C)NCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H36N4O6/c1-19(2)28(30(38)35-22-14-12-21(13-15-22)31(39)40)36-29(37)20(3)33-16-17-34-32(41)42-18-27-25-10-6-4-8-23(25)24-9-5-7-11-26(24)27/h4-15,19-20,27-28,33H,16-18H2,1-3H3,(H,34,41)(H,35,38)(H,36,37)(H,39,40)/t20-,28?/m0/s1 |
| InChIKey | ZUEMJNOSBJSMMF-CQHAJPFMSA-N |
| XLogP | 3.98 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|