C21H24FN3O — CID 59368143
1-(7-fluoro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-2-pyridin-4-ylpropan-2-ol (PubChem CID 59368143) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-(7-fluoro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-2-pyridin-4-ylpropan-2-ol.
| Compound Name | 1-(7-fluoro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-2-pyridin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 59368143 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-(7-fluoro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-2-pyridin-4-ylpropan-2-ol |
| SMILES | CN1CCc2c(n(CC(C)(O)c3ccncc3)c3c(F)cccc23)CC1 |
| InChI | InChI=1S/C21H24FN3O/c1-21(26,15-6-10-23-11-7-15)14-25-19-9-13-24(2)12-8-16(19)17-4-3-5-18(22)20(17)25/h3-7,10-11,26H,8-9,12-14H2,1-2H3 |
| InChIKey | COAHHCXYTUDJQM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|