C23H23N3O6S — CID 59369733
thiophen-2-ylmethyl N-[[4-[[(2S)-1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]carbamate (PubChem CID 59369733) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is thiophen-2-ylmethyl N-[[4-[[(2S)-1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]carbamate.
| Compound Name | thiophen-2-ylmethyl N-[[4-[[(2S)-1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59369733 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | thiophen-2-ylmethyl N-[[4-[[(2S)-1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)NO)cc1)OCc1cccs1 |
| InChI | InChI=1S/C23H23N3O6S/c27-18-9-5-15(6-10-18)12-20(22(29)26-31)25-21(28)17-7-3-16(4-8-17)13-24-23(30)32-14-19-2-1-11-33-19/h1-11,20,27,31H,12-14H2,(H,24,30)(H,25,28)(H,26,29)/t20-/m0/s1 |
| InChIKey | UKRYJUIZSZSPGL-FQEVSTJZSA-N |
| XLogP | 2.73 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|