C29H32Cl2N4O4 — CID 59370729
tert-butyl 6-[2-[[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-benzylamino]ethoxy]-3-chloroindazole-1-carboxylate (PubChem CID 59370729) has the molecular formula C29H32Cl2N4O4 and a molecular weight of 571.51 g/mol. Its IUPAC name is tert-butyl 6-[2-[[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-benzylamino]ethoxy]-3-chloroindazole-1-carboxylate.
| Compound Name | tert-butyl 6-[2-[[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-benzylamino]ethoxy]-3-chloroindazole-1-carboxylate |
|---|---|
| PubChem CID | 59370729 |
| Molecular Formula | C29H32Cl2N4O4 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | tert-butyl 6-[2-[[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-benzylamino]ethoxy]-3-chloroindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(Cl)c2ccc(OCCN(Cc3ccccc3)C[C@H](O)c3ccc(Cl)c(N)c3)cc21 |
| InChI | InChI=1S/C29H32Cl2N4O4/c1-29(2,3)39-28(37)35-25-16-21(10-11-22(25)27(31)33-35)38-14-13-34(17-19-7-5-4-6-8-19)18-26(36)20-9-12-23(30)24(32)15-20/h4-12,15-16,26,36H,13-14,17-18,32H2,1-3H3/t26-/m0/s1 |
| InChIKey | GWZGXHXYZCNLBT-SANMLTNESA-N |
| XLogP | 6.32 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|