C23H26Cl2N4O6 — CID 67356540
6-[2-[[2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-3-chloroindazole-3-carboxylic acid (PubChem CID 67356540) has the molecular formula C23H26Cl2N4O6 and a molecular weight of 525.39 g/mol. Its IUPAC name is 6-[2-[[2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-3-chloroindazole-3-carboxylic acid.
| Compound Name | 6-[2-[[2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-3-chloroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 67356540 |
| Molecular Formula | C23H26Cl2N4O6 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 6-[2-[[2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]-3-chloroindazole-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(CCOc1ccc2c(c1)N=NC2(Cl)C(=O)O)CC(O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C23H26Cl2N4O6/c1-22(2,3)35-21(33)29(12-19(30)13-4-7-16(24)17(26)10-13)8-9-34-14-5-6-15-18(11-14)27-28-23(15,25)20(31)32/h4-7,10-11,19,30H,8-9,12,26H2,1-3H3,(H,31,32) |
| InChIKey | IJFAQFJCJRAAID-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|