C24H29ClF3N3O4 — CID 88959050
tert-butyl N-[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-N-[2-[3-methyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]ethyl]carbamate (PubChem CID 88959050) has the molecular formula C24H29ClF3N3O4 and a molecular weight of 515.96 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-N-[2-[3-methyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-N-[2-[3-methyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 88959050 |
| Molecular Formula | C24H29ClF3N3O4 |
| Molecular Weight | 515.96 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | tert-butyl N-[(2R)-2-(3-amino-4-chlorophenyl)-2-hydroxyethyl]-N-[2-[3-methyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]ethyl]carbamate |
| SMILES | [H]/N=C(/c1ccc(OCCN(C[C@H](O)c2ccc(Cl)c(N)c2)C(=O)OC(C)(C)C)cc1C)C(F)(F)F |
| InChI | InChI=1S/C24H29ClF3N3O4/c1-14-11-16(6-7-17(14)21(30)24(26,27)28)34-10-9-31(22(33)35-23(2,3)4)13-20(32)15-5-8-18(25)19(29)12-15/h5-8,11-12,20,30,32H,9-10,13,29H2,1-4H3/b30-21-/t20-/m0/s1 |
| InChIKey | XONQDURTOSPOQY-FICJDRBXSA-N |
| XLogP | 5.51 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|