C33H38N4O2 — CID 59373277
9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-3-(cyclobutylmethyl)-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 59373277) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-3-(cyclobutylmethyl)-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-3-(cyclobutylmethyl)-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 59373277 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-3-(cyclobutylmethyl)-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1=NC2(CCCN(C3CCN(C(=O)c4c5ccccc5cc5ccccc45)CC3)C2)C(=O)N1CC1CCC1 |
| InChI | InChI=1S/C33H38N4O2/c1-23-34-33(32(39)37(23)21-24-8-6-9-24)16-7-17-36(22-33)27-14-18-35(19-15-27)31(38)30-28-12-4-2-10-25(28)20-26-11-3-5-13-29(26)30/h2-5,10-13,20,24,27H,6-9,14-19,21-22H2,1H3 |
| InChIKey | LOWWKTJPWXKBGB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|