C30H39N3O2 — CID 143762942
anthracen-9-yl-(4-piperidin-1-ylpiperidin-1-yl)methanone;N,N-diethylformamide (PubChem CID 143762942) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is anthracen-9-yl-(4-piperidin-1-ylpiperidin-1-yl)methanone;N,N-diethylformamide.
| Compound Name | anthracen-9-yl-(4-piperidin-1-ylpiperidin-1-yl)methanone;N,N-diethylformamide |
|---|---|
| PubChem CID | 143762942 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | anthracen-9-yl-(4-piperidin-1-ylpiperidin-1-yl)methanone;N,N-diethylformamide |
| SMILES | CCN(C=O)CC.O=C(c1c2ccccc2cc2ccccc12)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H28N2O.C5H11NO/c28-25(27-16-12-21(13-17-27)26-14-6-1-7-15-26)24-22-10-4-2-8-19(22)18-20-9-3-5-11-23(20)24;1-3-6(4-2)5-7/h2-5,8-11,18,21H,1,6-7,12-17H2;5H,3-4H2,1-2H3 |
| InChIKey | SSJNRMIMVHBGCG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|