C34H37N3O2 — CID 87953121
1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-ethyl-N-phenylpiperidine-3-carboxamide (PubChem CID 87953121) has the molecular formula C34H37N3O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-ethyl-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-ethyl-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 87953121 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-ethyl-N-phenylpiperidine-3-carboxamide |
| SMILES | CCN(C(=O)C1CCCN(C2CCN(C(=O)c3c4ccccc4cc4ccccc34)CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C34H37N3O2/c1-2-37(29-14-4-3-5-15-29)33(38)27-13-10-20-36(24-27)28-18-21-35(22-19-28)34(39)32-30-16-8-6-11-25(30)23-26-12-7-9-17-31(26)32/h3-9,11-12,14-17,23,27-28H,2,10,13,18-22,24H2,1H3 |
| InChIKey | QGQFXBWOIVXCEA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|