C32H40N4O2 — CID 23589178
[(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(2-ethylpiperazin-1-yl)methanone (PubChem CID 23589178) has the molecular formula C32H40N4O2 and a molecular weight of 512.70 g/mol. Its IUPAC name is [(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(2-ethylpiperazin-1-yl)methanone.
| Compound Name | [(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(2-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 23589178 |
| Molecular Formula | C32H40N4O2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | [(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(2-ethylpiperazin-1-yl)methanone |
| SMILES | CCC1CNCCN1C(=O)[C@@H]1CCCN(C2CCN(C(=O)c3c4ccccc4cc4ccccc34)CC2)C1 |
| InChI | InChI=1S/C32H40N4O2/c1-2-26-21-33-15-19-36(26)31(37)25-10-7-16-35(22-25)27-13-17-34(18-14-27)32(38)30-28-11-5-3-8-23(28)20-24-9-4-6-12-29(24)30/h3-6,8-9,11-12,20,25-27,33H,2,7,10,13-19,21-22H2,1H3/t25-,26?/m1/s1 |
| InChIKey | PXYHRJONSBTRFM-DCWQJPKNSA-N |
| XLogP | 4.52 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|