C32H36N4O2 — CID 91164144
1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-(2-cyanoethyl)-N-cyclopropylpiperidine-3-carboxamide (PubChem CID 91164144) has the molecular formula C32H36N4O2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-(2-cyanoethyl)-N-cyclopropylpiperidine-3-carboxamide.
| Compound Name | 1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-(2-cyanoethyl)-N-cyclopropylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 91164144 |
| Molecular Formula | C32H36N4O2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-(2-cyanoethyl)-N-cyclopropylpiperidine-3-carboxamide |
| SMILES | N#CCCN(C(=O)C1CCCN(C2CCN(C(=O)c3c4ccccc4cc4ccccc34)CC2)C1)C1CC1 |
| InChI | InChI=1S/C32H36N4O2/c33-16-6-18-36(27-12-13-27)31(37)25-9-5-17-35(22-25)26-14-19-34(20-15-26)32(38)30-28-10-3-1-7-23(28)21-24-8-2-4-11-29(24)30/h1-4,7-8,10-11,21,25-27H,5-6,9,12-15,17-20,22H2 |
| InChIKey | DPPTVWNGLFVJJM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|