C30H35N3O2 — CID 10174028
(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-cyclobutylpiperidine-3-carboxamide (PubChem CID 10174028) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is (3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-cyclobutylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-cyclobutylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 10174028 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]-N-cyclobutylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCC1)[C@@H]1CCCN(C2CCN(C(=O)c3c4ccccc4cc4ccccc34)CC2)C1 |
| InChI | InChI=1S/C30H35N3O2/c34-29(31-24-10-5-11-24)23-9-6-16-33(20-23)25-14-17-32(18-15-25)30(35)28-26-12-3-1-7-21(26)19-22-8-2-4-13-27(22)28/h1-4,7-8,12-13,19,23-25H,5-6,9-11,14-18,20H2,(H,31,34)/t23-/m1/s1 |
| InChIKey | YGHPPMKOFFCNSE-HSZRJFAPSA-N |
| XLogP | 4.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|