C31H35N3O2 — CID 22263182
[1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 22263182) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is [1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | [1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 22263182 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | [1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(c1c2ccccc2cc2ccccc12)N1CCC(N2CCCC(C(=O)N3CC=CCC3)C2)CC1 |
| InChI | InChI=1S/C31H35N3O2/c35-30(32-16-6-1-7-17-32)25-11-8-18-34(22-25)26-14-19-33(20-15-26)31(36)29-27-12-4-2-9-23(27)21-24-10-3-5-13-28(24)29/h1-6,9-10,12-13,21,25-26H,7-8,11,14-20,22H2 |
| InChIKey | HHROVAZZTQHZSA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|