C31H37N3O2 — CID 46880209
[4-[4-(anthracene-9-carbonyl)piperazin-1-yl]piperidin-1-yl]-cyclohexylmethanone (PubChem CID 46880209) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is [4-[4-(anthracene-9-carbonyl)piperazin-1-yl]piperidin-1-yl]-cyclohexylmethanone.
| Compound Name | [4-[4-(anthracene-9-carbonyl)piperazin-1-yl]piperidin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 46880209 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | [4-[4-(anthracene-9-carbonyl)piperazin-1-yl]piperidin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(c1c2ccccc2cc2ccccc12)N1CCN(C2CCN(C(=O)C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C31H37N3O2/c35-30(23-8-2-1-3-9-23)33-16-14-26(15-17-33)32-18-20-34(21-19-32)31(36)29-27-12-6-4-10-24(27)22-25-11-5-7-13-28(25)29/h4-7,10-13,22-23,26H,1-3,8-9,14-21H2 |
| InChIKey | HFLMAGRECQLDDB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|