C24H27N5O3 — CID 59374306
ethyl 4-[3-[4-[(5-methyl-2-pyridinyl)amino]phenoxy]pyrazin-2-yl]piperidine-1-carboxylate (PubChem CID 59374306) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 4-[3-[4-[(5-methyl-2-pyridinyl)amino]phenoxy]pyrazin-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-[4-[(5-methyl-2-pyridinyl)amino]phenoxy]pyrazin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59374306 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | ethyl 4-[3-[4-[(5-methyl-2-pyridinyl)amino]phenoxy]pyrazin-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2nccnc2Oc2ccc(Nc3ccc(C)cn3)cc2)CC1 |
| InChI | InChI=1S/C24H27N5O3/c1-3-31-24(30)29-14-10-18(11-15-29)22-23(26-13-12-25-22)32-20-7-5-19(6-8-20)28-21-9-4-17(2)16-27-21/h4-9,12-13,16,18H,3,10-11,14-15H2,1-2H3,(H,27,28) |
| InChIKey | UJQBUXIQXFHMFK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |