About [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate
[2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate (PubChem CID 59374931) has the molecular formula C15H19N3O6
and a molecular weight of 337.33 g/mol. Its IUPAC name is [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate.
Molecular Properties
| Compound Name | [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate |
| PubChem CID | 59374931 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate |
| SMILES | CCC(=O)N(C)c1cc([N+](=O)[O-])ccc1OC(=O)CCNC(C)=O |
| InChI | InChI=1S/C15H19N3O6/c1-4-14(20)17(3)12-9-11(18(22)23)5-6-13(12)24-15(21)7-8-16-10(2)19/h5-6,9H,4,7-8H2,1-3H3,(H,16,19) |
| InChIKey | QTYPUGBUXXVQSQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate?
The IUPAC name of [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate (CID 59374931) is [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate.
What is the SMILES notation for [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate?
The canonical SMILES for [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate is CCC(=O)N(C)c1cc([N+](=O)[O-])ccc1OC(=O)CCNC(C)=O.
What is the InChIKey of [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate?
The InChIKey is QTYPUGBUXXVQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O6/c1-4-14(20)17(3)12-9-11(18(22)23)5-6-13(12)24-15(21)7-8-16-10(2)19/h5-6,9H,4,7-8H2,1-3H3,(H,16,19).
What are the key properties of [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate?
[2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate has a molecular weight of 337.33 g/mol, XLogP of 1.40, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[methyl(propanoyl)amino]-4-nitrophenyl] 3-acetamidopropanoate is sourced from PubChem (CID 59374931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).