C17H21NO5S2 — CID 59375206
[4-(butylsulfonylamino)phenyl] 4-methylbenzenesulfonate (PubChem CID 59375206) has the molecular formula C17H21NO5S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is [4-(butylsulfonylamino)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(butylsulfonylamino)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59375206 |
| Molecular Formula | C17H21NO5S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [4-(butylsulfonylamino)phenyl] 4-methylbenzenesulfonate |
| SMILES | CCCCS(=O)(=O)Nc1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H21NO5S2/c1-3-4-13-24(19,20)18-15-7-9-16(10-8-15)23-25(21,22)17-11-5-14(2)6-12-17/h5-12,18H,3-4,13H2,1-2H3 |
| InChIKey | XBKRYQXOBJEAGH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|