C27H32N6O5 — CID 59375855
12-methoxy-19-(2-methylpropyl)-14,23-dioxa-2,4,6,8,17,20-hexazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3(30),4,6,9(29),10,12,24,27-nonaene-18,21-dione (PubChem CID 59375855) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is 12-methoxy-19-(2-methylpropyl)-14,23-dioxa-2,4,6,8,17,20-hexazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3(30),4,6,9(29),10,12,24,27-nonaene-18,21-dione.
| Compound Name | 12-methoxy-19-(2-methylpropyl)-14,23-dioxa-2,4,6,8,17,20-hexazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3(30),4,6,9(29),10,12,24,27-nonaene-18,21-dione |
|---|---|
| PubChem CID | 59375855 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 12-methoxy-19-(2-methylpropyl)-14,23-dioxa-2,4,6,8,17,20-hexazatetracyclo[22.2.2.13,7.19,13]triaconta-1(26),3(30),4,6,9(29),10,12,24,27-nonaene-18,21-dione |
| SMILES | COc1ccc2cc1OCCNC(=O)C(CC(C)C)NC(=O)COc1ccc(cc1)Nc1cc(ncn1)N2 |
| InChI | InChI=1S/C27H32N6O5/c1-17(2)12-21-27(35)28-10-11-37-23-13-19(6-9-22(23)36-3)32-25-14-24(29-16-30-25)31-18-4-7-20(8-5-18)38-15-26(34)33-21/h4-9,13-14,16-17,21H,10-12,15H2,1-3H3,(H,28,35)(H,33,34)(H2,29,30,31,32) |
| InChIKey | SKMUTUOUJXLLCB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 135.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|