C37H43N7O4 — CID 59375724
18-methoxy-25-(2-phenylethyl)-20-oxa-8,10,12,14,23,26,29-heptazapentacyclo[27.2.2.13,7.19,13.115,19]hexatriaconta-3(36),4,6,9(35),10,12,15(34),16,18-nonaene-24,27-dione (PubChem CID 59375724) has the molecular formula C37H43N7O4 and a molecular weight of 649.80 g/mol. Its IUPAC name is 18-methoxy-25-(2-phenylethyl)-20-oxa-8,10,12,14,23,26,29-heptazapentacyclo[27.2.2.13,7.19,13.115,19]hexatriaconta-3(36),4,6,9(35),10,12,15(34),16,18-nonaene-24,27-dione.
| Compound Name | 18-methoxy-25-(2-phenylethyl)-20-oxa-8,10,12,14,23,26,29-heptazapentacyclo[27.2.2.13,7.19,13.115,19]hexatriaconta-3(36),4,6,9(35),10,12,15(34),16,18-nonaene-24,27-dione |
|---|---|
| PubChem CID | 59375724 |
| Molecular Formula | C37H43N7O4 |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | 18-methoxy-25-(2-phenylethyl)-20-oxa-8,10,12,14,23,26,29-heptazapentacyclo[27.2.2.13,7.19,13.115,19]hexatriaconta-3(36),4,6,9(35),10,12,15(34),16,18-nonaene-24,27-dione |
| SMILES | COc1ccc2cc1OCCNC(=O)C(CCc1ccccc1)NC(=O)CN1CCC(CC1)Cc1cccc(c1)Nc1cc(ncn1)N2 |
| InChI | InChI=1S/C37H43N7O4/c1-47-32-13-11-30-22-33(32)48-19-16-38-37(46)31(12-10-26-6-3-2-4-7-26)43-36(45)24-44-17-14-27(15-18-44)20-28-8-5-9-29(21-28)41-34-23-35(42-30)40-25-39-34/h2-9,11,13,21-23,25,27,31H,10,12,14-20,24H2,1H3,(H,38,46)(H,43,45)(H2,39,40,41,42) |
| InChIKey | RPQBCNODEGOWRR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 129.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|