C29H35N7O2 — CID 160713796
24-methyl-1,10,12,14,22,25,28-heptazapentacyclo[26.2.2.13,7.19,13.115,19]pentatriaconta-3,5,7(35),9(34),10,12,15,17,19(33)-nonaene-23,26-dione (PubChem CID 160713796) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 24-methyl-1,10,12,14,22,25,28-heptazapentacyclo[26.2.2.13,7.19,13.115,19]pentatriaconta-3,5,7(35),9(34),10,12,15,17,19(33)-nonaene-23,26-dione.
| Compound Name | 24-methyl-1,10,12,14,22,25,28-heptazapentacyclo[26.2.2.13,7.19,13.115,19]pentatriaconta-3,5,7(35),9(34),10,12,15,17,19(33)-nonaene-23,26-dione |
|---|---|
| PubChem CID | 160713796 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 24-methyl-1,10,12,14,22,25,28-heptazapentacyclo[26.2.2.13,7.19,13.115,19]pentatriaconta-3,5,7(35),9(34),10,12,15,17,19(33)-nonaene-23,26-dione |
| SMILES | CC1NC(=O)CN2CCN(CC2)Cc2cccc(c2)Cc2cc(ncn2)Nc2cccc(c2)CCNC1=O |
| InChI | InChI=1S/C29H35N7O2/c1-21-29(38)30-9-8-22-4-3-7-25(15-22)34-27-17-26(31-20-32-27)16-23-5-2-6-24(14-23)18-35-10-12-36(13-11-35)19-28(37)33-21/h2-7,14-15,17,20-21H,8-13,16,18-19H2,1H3,(H,30,38)(H,33,37)(H,31,32,34) |
| InChIKey | RSEVTHJOKREJHS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |