C28H36N8O — CID 59375827
21-ethyl-1,8,10,12,14,21,24,27-octazapentacyclo[25.2.2.13,7.19,13.115,19]tetratriaconta-3(34),4,6,9(33),10,12,15,17,19(32)-nonaen-25-one (PubChem CID 59375827) has the molecular formula C28H36N8O and a molecular weight of 500.65 g/mol. Its IUPAC name is 21-ethyl-1,8,10,12,14,21,24,27-octazapentacyclo[25.2.2.13,7.19,13.115,19]tetratriaconta-3(34),4,6,9(33),10,12,15,17,19(32)-nonaen-25-one.
| Compound Name | 21-ethyl-1,8,10,12,14,21,24,27-octazapentacyclo[25.2.2.13,7.19,13.115,19]tetratriaconta-3(34),4,6,9(33),10,12,15,17,19(32)-nonaen-25-one |
|---|---|
| PubChem CID | 59375827 |
| Molecular Formula | C28H36N8O |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 21-ethyl-1,8,10,12,14,21,24,27-octazapentacyclo[25.2.2.13,7.19,13.115,19]tetratriaconta-3(34),4,6,9(33),10,12,15,17,19(32)-nonaen-25-one |
| SMILES | CCN1CCNC(=O)CN2CCN(CC2)Cc2cccc(c2)Nc2cc(ncn2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C28H36N8O/c1-2-34-10-9-29-28(37)20-36-13-11-35(12-14-36)19-23-6-4-8-25(16-23)33-27-17-26(30-21-31-27)32-24-7-3-5-22(15-24)18-34/h3-8,15-17,21H,2,9-14,18-20H2,1H3,(H,29,37)(H2,30,31,32,33) |
| InChIKey | SIBAJHQBTHPERL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |