C23H26N6O — CID 59148950
14-ethyl-3,5,7,14,17,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),21(25),22-nonaen-16-one (PubChem CID 59148950) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 14-ethyl-3,5,7,14,17,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),21(25),22-nonaen-16-one.
| Compound Name | 14-ethyl-3,5,7,14,17,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),21(25),22-nonaen-16-one |
|---|---|
| PubChem CID | 59148950 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 14-ethyl-3,5,7,14,17,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),21(25),22-nonaen-16-one |
| SMILES | CCN1CC(=O)NCCCc2cccc(c2)-c2ncnc(n2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C23H26N6O/c1-2-29-14-18-7-4-10-20(13-18)27-23-26-16-25-22(28-23)19-9-3-6-17(12-19)8-5-11-24-21(30)15-29/h3-4,6-7,9-10,12-13,16H,2,5,8,11,14-15H2,1H3,(H,24,30)(H,25,26,27,28) |
| InChIKey | NRJZLTXKCHWGOG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |