C25H30N6O — CID 143387534
formaldehyde;3,5,7,14,19,30-hexazapentacyclo[21.3.1.12,6.18,12.114,18]triaconta-1(26),2(30),3,5,8,10,12(29),23(27),24-nonaene (PubChem CID 143387534) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is formaldehyde;3,5,7,14,19,30-hexazapentacyclo[21.3.1.12,6.18,12.114,18]triaconta-1(26),2(30),3,5,8,10,12(29),23(27),24-nonaene.
| Compound Name | formaldehyde;3,5,7,14,19,30-hexazapentacyclo[21.3.1.12,6.18,12.114,18]triaconta-1(26),2(30),3,5,8,10,12(29),23(27),24-nonaene |
|---|---|
| PubChem CID | 143387534 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | formaldehyde;3,5,7,14,19,30-hexazapentacyclo[21.3.1.12,6.18,12.114,18]triaconta-1(26),2(30),3,5,8,10,12(29),23(27),24-nonaene |
| SMILES | C=O.c1cc2cc(c1)Nc1ncnc(n1)-c1cccc(c1)CCCNC1CCCN(C2)C1 |
| InChI | InChI=1S/C24H28N6.CH2O/c1-5-18-7-3-11-25-22-10-4-12-30(16-22)15-19-6-2-9-21(14-19)28-24-27-17-26-23(29-24)20(8-1)13-18;1-2/h1-2,5-6,8-9,13-14,17,22,25H,3-4,7,10-12,15-16H2,(H,26,27,28,29);1H2 |
| InChIKey | YWIAQOFGOKTWKV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |