C24H27N7O — CID 59148926
3,5,7,14,20,26,31-heptazapentacyclo[22.3.1.12,6.18,12.114,18]hentriaconta-1(27),2(31),3,5,8,10,12(30),24(28),25-nonaen-19-one (PubChem CID 59148926) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 3,5,7,14,20,26,31-heptazapentacyclo[22.3.1.12,6.18,12.114,18]hentriaconta-1(27),2(31),3,5,8,10,12(30),24(28),25-nonaen-19-one.
| Compound Name | 3,5,7,14,20,26,31-heptazapentacyclo[22.3.1.12,6.18,12.114,18]hentriaconta-1(27),2(31),3,5,8,10,12(30),24(28),25-nonaen-19-one |
|---|---|
| PubChem CID | 59148926 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 3,5,7,14,20,26,31-heptazapentacyclo[22.3.1.12,6.18,12.114,18]hentriaconta-1(27),2(31),3,5,8,10,12(30),24(28),25-nonaen-19-one |
| SMILES | O=C1NCCCc2cncc(c2)-c2ncnc(n2)Nc2cccc(c2)CN2CCCC1C2 |
| InChI | InChI=1S/C24H27N7O/c32-23-19-6-3-9-31(15-19)14-18-4-1-7-21(11-18)29-24-28-16-27-22(30-24)20-10-17(12-25-13-20)5-2-8-26-23/h1,4,7,10-13,16,19H,2-3,5-6,8-9,14-15H2,(H,26,32)(H,27,28,29,30) |
| InChIKey | XECPZBKUXYNVBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |