C28H37N7O — CID 159103116
24-ethyl-2,4,6,8,15,21,24-heptazapentacyclo[24.3.1.13,7.19,13.015,19]dotriaconta-1(29),3(32),4,6,9,11,13(31),26(30),27-nonaen-20-one;methane (PubChem CID 159103116) has the molecular formula C28H37N7O and a molecular weight of 487.65 g/mol. Its IUPAC name is 24-ethyl-2,4,6,8,15,21,24-heptazapentacyclo[24.3.1.13,7.19,13.015,19]dotriaconta-1(29),3(32),4,6,9,11,13(31),26(30),27-nonaen-20-one;methane.
| Compound Name | 24-ethyl-2,4,6,8,15,21,24-heptazapentacyclo[24.3.1.13,7.19,13.015,19]dotriaconta-1(29),3(32),4,6,9,11,13(31),26(30),27-nonaen-20-one;methane |
|---|---|
| PubChem CID | 159103116 |
| Molecular Formula | C28H37N7O |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 24-ethyl-2,4,6,8,15,21,24-heptazapentacyclo[24.3.1.13,7.19,13.015,19]dotriaconta-1(29),3(32),4,6,9,11,13(31),26(30),27-nonaen-20-one;methane |
| SMILES | C.CCN1CCNC(=O)C2CCCN2Cc2cccc(c2)Nc2cc(ncn2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C27H33N7O.CH4/c1-2-33-13-11-28-27(35)24-10-5-12-34(24)18-21-7-4-9-23(15-21)32-26-16-25(29-19-30-26)31-22-8-3-6-20(14-22)17-33;/h3-4,6-9,14-16,19,24H,2,5,10-13,17-18H2,1H3,(H,28,35)(H2,29,30,31,32);1H4 |
| InChIKey | KDNNUMUMKDEOCA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |