C31H40N6O2 — CID 143239578
28-butan-2-yl-10-methyl-26-oxa-2,4,6,8,15,22-hexazapentacyclo[25.3.1.13,7.19,13.015,20]tritriaconta-1(31),3(33),4,6,9,11,13(32),27,29-nonaen-21-one (PubChem CID 143239578) has the molecular formula C31H40N6O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 28-butan-2-yl-10-methyl-26-oxa-2,4,6,8,15,22-hexazapentacyclo[25.3.1.13,7.19,13.015,20]tritriaconta-1(31),3(33),4,6,9,11,13(32),27,29-nonaen-21-one.
| Compound Name | 28-butan-2-yl-10-methyl-26-oxa-2,4,6,8,15,22-hexazapentacyclo[25.3.1.13,7.19,13.015,20]tritriaconta-1(31),3(33),4,6,9,11,13(32),27,29-nonaen-21-one |
|---|---|
| PubChem CID | 143239578 |
| Molecular Formula | C31H40N6O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 28-butan-2-yl-10-methyl-26-oxa-2,4,6,8,15,22-hexazapentacyclo[25.3.1.13,7.19,13.015,20]tritriaconta-1(31),3(33),4,6,9,11,13(32),27,29-nonaen-21-one |
| SMILES | CCC(C)c1ccc2cc1OCCCNC(=O)C1CCCCN1Cc1ccc(C)c(c1)Nc1cc(ncn1)N2 |
| InChI | InChI=1S/C31H40N6O2/c1-4-21(2)25-12-11-24-17-28(25)39-15-7-13-32-31(38)27-8-5-6-14-37(27)19-23-10-9-22(3)26(16-23)36-30-18-29(35-24)33-20-34-30/h9-12,16-18,20-21,27H,4-8,13-15,19H2,1-3H3,(H,32,38)(H2,33,34,35,36) |
| InChIKey | CQZTUNYHHPJXMF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |