C25H29ClN6O2 — CID 11663010
11-chloro-23-ethyl-15-oxa-2,6,8,19,23,30-hexazatetracyclo[23.2.2.13,7.09,14]triaconta-1(27),3(30),4,6,9(14),10,12,25,28-nonaen-20-one (PubChem CID 11663010) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 11-chloro-23-ethyl-15-oxa-2,6,8,19,23,30-hexazatetracyclo[23.2.2.13,7.09,14]triaconta-1(27),3(30),4,6,9(14),10,12,25,28-nonaen-20-one.
| Compound Name | 11-chloro-23-ethyl-15-oxa-2,6,8,19,23,30-hexazatetracyclo[23.2.2.13,7.09,14]triaconta-1(27),3(30),4,6,9(14),10,12,25,28-nonaen-20-one |
|---|---|
| PubChem CID | 11663010 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 11-chloro-23-ethyl-15-oxa-2,6,8,19,23,30-hexazatetracyclo[23.2.2.13,7.09,14]triaconta-1(27),3(30),4,6,9(14),10,12,25,28-nonaen-20-one |
| SMILES | CCN1CCC(=O)NCCCOc2ccc(Cl)cc2Nc2nccc(n2)Nc2ccc(cc2)C1 |
| InChI | InChI=1S/C25H29ClN6O2/c1-2-32-14-11-24(33)27-12-3-15-34-22-9-6-19(26)16-21(22)30-25-28-13-10-23(31-25)29-20-7-4-18(17-32)5-8-20/h4-10,13,16H,2-3,11-12,14-15,17H2,1H3,(H,27,33)(H2,28,29,30,31) |
| InChIKey | BTJDEAIEFANFPK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |