C29H34ClN5O3 — CID 133073599
6-chloro-12-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one (PubChem CID 133073599) has the molecular formula C29H34ClN5O3 and a molecular weight of 536.08 g/mol. Its IUPAC name is 6-chloro-12-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one.
| Compound Name | 6-chloro-12-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
|---|---|
| PubChem CID | 133073599 |
| Molecular Formula | C29H34ClN5O3 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 6-chloro-12-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
| SMILES | O=C1CN(Cc2ccnc(N3CCCCC3)n2)CCCCCOc2ccccc2Oc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C29H34ClN5O3/c30-22-11-12-25-24(19-22)33-28(36)21-34(15-5-2-8-18-37-26-9-3-4-10-27(26)38-25)20-23-13-14-31-29(32-23)35-16-6-1-7-17-35/h3-4,9-14,19H,1-2,5-8,15-18,20-21H2,(H,33,36) |
| InChIKey | IGMUCNGYVCTPFU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |