C25H27ClN4O4 — CID 110066028
6-chloro-12-(3-imidazol-1-ylpropanoyl)-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one (PubChem CID 110066028) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is 6-chloro-12-(3-imidazol-1-ylpropanoyl)-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one.
| Compound Name | 6-chloro-12-(3-imidazol-1-ylpropanoyl)-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
|---|---|
| PubChem CID | 110066028 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 6-chloro-12-(3-imidazol-1-ylpropanoyl)-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
| SMILES | O=C1CN(C(=O)CCn2ccnc2)CCCCCOc2ccccc2Oc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C25H27ClN4O4/c26-19-8-9-21-20(16-19)28-24(31)17-30(25(32)10-13-29-14-11-27-18-29)12-4-1-5-15-33-22-6-2-3-7-23(22)34-21/h2-3,6-9,11,14,16,18H,1,4-5,10,12-13,15,17H2,(H,28,31) |
| InChIKey | KDXDJCWTGNQFDO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |