C32H36ClN3O5 — CID 133068008
15-[2-(4-benzylpiperidin-1-yl)acetyl]-21-chloro-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one (PubChem CID 133068008) has the molecular formula C32H36ClN3O5 and a molecular weight of 578.11 g/mol. Its IUPAC name is 15-[2-(4-benzylpiperidin-1-yl)acetyl]-21-chloro-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one.
| Compound Name | 15-[2-(4-benzylpiperidin-1-yl)acetyl]-21-chloro-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one |
|---|---|
| PubChem CID | 133068008 |
| Molecular Formula | C32H36ClN3O5 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 15-[2-(4-benzylpiperidin-1-yl)acetyl]-21-chloro-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one |
| SMILES | O=C1CN(C(=O)CN2CCC(Cc3ccccc3)CC2)CCOCCOc2ccccc2Oc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C32H36ClN3O5/c33-26-10-11-28-27(21-26)34-31(37)22-36(16-17-39-18-19-40-29-8-4-5-9-30(29)41-28)32(38)23-35-14-12-25(13-15-35)20-24-6-2-1-3-7-24/h1-11,21,25H,12-20,22-23H2,(H,34,37) |
| InChIKey | AOAYWONHBBAJIM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |