C31H34ClN3O5 — CID 110066606
21-chloro-15-[[1-(2-methoxyethyl)-2-methylindol-3-yl]methyl]-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one (PubChem CID 110066606) has the molecular formula C31H34ClN3O5 and a molecular weight of 564.08 g/mol. Its IUPAC name is 21-chloro-15-[[1-(2-methoxyethyl)-2-methylindol-3-yl]methyl]-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one.
| Compound Name | 21-chloro-15-[[1-(2-methoxyethyl)-2-methylindol-3-yl]methyl]-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one |
|---|---|
| PubChem CID | 110066606 |
| Molecular Formula | C31H34ClN3O5 |
| Molecular Weight | 564.08 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 21-chloro-15-[[1-(2-methoxyethyl)-2-methylindol-3-yl]methyl]-2,9,12-trioxa-15,18-diazatricyclo[17.4.0.03,8]tricosa-1(19),3,5,7,20,22-hexaen-17-one |
| SMILES | COCCn1c(C)c(CN2CCOCCOc3ccccc3Oc3ccc(Cl)cc3NC(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C31H34ClN3O5/c1-22-25(24-7-3-4-8-27(24)35(22)14-15-37-2)20-34-13-16-38-17-18-39-29-9-5-6-10-30(29)40-28-12-11-23(32)19-26(28)33-31(36)21-34/h3-12,19H,13-18,20-21H2,1-2H3,(H,33,36) |
| InChIKey | SKYJEXFOPUWMKJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.08 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|