C28H33ClN4O4 — CID 110066029
6-chloro-12-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one (PubChem CID 110066029) has the molecular formula C28H33ClN4O4 and a molecular weight of 525.05 g/mol. Its IUPAC name is 6-chloro-12-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one.
| Compound Name | 6-chloro-12-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
|---|---|
| PubChem CID | 110066029 |
| Molecular Formula | C28H33ClN4O4 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 6-chloro-12-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
| SMILES | CC(C)c1nccn1CCC(=O)N1CCCCCOc2ccccc2Oc2ccc(Cl)cc2NC(=O)C1 |
| InChI | InChI=1S/C28H33ClN4O4/c1-20(2)28-30-13-16-32(28)15-12-27(35)33-14-6-3-7-17-36-24-8-4-5-9-25(24)37-23-11-10-21(29)18-22(23)31-26(34)19-33/h4-5,8-11,13,16,18,20H,3,6-7,12,14-15,17,19H2,1-2H3,(H,31,34) |
| InChIKey | RBZYSBDRDVUMQA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |