C30H44N4O4 — CID 133079054
(3R,7R)-17-ethyl-5-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one (PubChem CID 133079054) has the molecular formula C30H44N4O4 and a molecular weight of 524.71 g/mol. Its IUPAC name is (3R,7R)-17-ethyl-5-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one.
| Compound Name | (3R,7R)-17-ethyl-5-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
|---|---|
| PubChem CID | 133079054 |
| Molecular Formula | C30H44N4O4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | (3R,7R)-17-ethyl-5-[3-(2-propan-2-ylimidazol-1-yl)propanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
| SMILES | CCN1CCCCCCCCO[C@@H]2CN(C(=O)CCn3ccnc3C(C)C)C[C@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C30H44N4O4/c1-4-32-17-11-7-5-6-8-12-20-37-26-21-34(28(35)15-18-33-19-16-31-29(33)23(2)3)22-27(26)38-25-14-10-9-13-24(25)30(32)36/h9-10,13-14,16,19,23,26-27H,4-8,11-12,15,17-18,20-22H2,1-3H3/t26-,27-/m1/s1 |
| InChIKey | NEUBPXRJVQNUPD-KAYWLYCHSA-N |
| XLogP | 4.89 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |