C26H37N5O4 — CID 155994189
(3R,7R)-17-methyl-5-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one (PubChem CID 155994189) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is (3R,7R)-17-methyl-5-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one.
| Compound Name | (3R,7R)-17-methyl-5-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
|---|---|
| PubChem CID | 155994189 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (3R,7R)-17-methyl-5-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
| SMILES | CN1CCCCCCCCO[C@@H]2CN(C(=O)CCCn3cncn3)C[C@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C26H37N5O4/c1-29-14-8-4-2-3-5-9-16-34-23-17-30(25(32)13-10-15-31-20-27-19-28-31)18-24(23)35-22-12-7-6-11-21(22)26(29)33/h6-7,11-12,19-20,23-24H,2-5,8-10,13-18H2,1H3/t23-,24-/m1/s1 |
| InChIKey | XKAJXCXQZSYQPC-DNQXCXABSA-N |
| XLogP | 3.16 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |