C24H33N5O4 — CID 155994185
(3R,7R)-17-methyl-5-[2-(1,2,4-triazol-1-yl)acetyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one (PubChem CID 155994185) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is (3R,7R)-17-methyl-5-[2-(1,2,4-triazol-1-yl)acetyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one.
| Compound Name | (3R,7R)-17-methyl-5-[2-(1,2,4-triazol-1-yl)acetyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
|---|---|
| PubChem CID | 155994185 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | (3R,7R)-17-methyl-5-[2-(1,2,4-triazol-1-yl)acetyl]-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
| SMILES | CN1CCCCCCCCO[C@@H]2CN(C(=O)Cn3cncn3)C[C@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C24H33N5O4/c1-27-12-8-4-2-3-5-9-13-32-21-14-28(23(30)16-29-18-25-17-26-29)15-22(21)33-20-11-7-6-10-19(20)24(27)31/h6-7,10-11,17-18,21-22H,2-5,8-9,12-16H2,1H3/t21-,22-/m1/s1 |
| InChIKey | JWLCOVSLZKNAKQ-FGZHOGPDSA-N |
| XLogP | 2.38 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |