C28H35FN2O4 — CID 155994215
(3R,7R)-5-[2-(4-fluorophenyl)acetyl]-17-methyl-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one (PubChem CID 155994215) has the molecular formula C28H35FN2O4 and a molecular weight of 482.60 g/mol. Its IUPAC name is (3R,7R)-5-[2-(4-fluorophenyl)acetyl]-17-methyl-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one.
| Compound Name | (3R,7R)-5-[2-(4-fluorophenyl)acetyl]-17-methyl-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
|---|---|
| PubChem CID | 155994215 |
| Molecular Formula | C28H35FN2O4 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (3R,7R)-5-[2-(4-fluorophenyl)acetyl]-17-methyl-2,8-dioxa-5,17-diazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-trien-18-one |
| SMILES | CN1CCCCCCCCO[C@@H]2CN(C(=O)Cc3ccc(F)cc3)C[C@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C28H35FN2O4/c1-30-16-8-4-2-3-5-9-17-34-25-19-31(27(32)18-21-12-14-22(29)15-13-21)20-26(25)35-24-11-7-6-10-23(24)28(30)33/h6-7,10-15,25-26H,2-5,8-9,16-20H2,1H3/t25-,26-/m1/s1 |
| InChIKey | GKMINUMQZYMIBE-CLJLJLNGSA-N |
| XLogP | 4.47 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |