C30H34ClN3O5 — CID 110066041
6-chloro-12-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one (PubChem CID 110066041) has the molecular formula C30H34ClN3O5 and a molecular weight of 552.07 g/mol. Its IUPAC name is 6-chloro-12-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one.
| Compound Name | 6-chloro-12-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
|---|---|
| PubChem CID | 110066041 |
| Molecular Formula | C30H34ClN3O5 |
| Molecular Weight | 552.07 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 6-chloro-12-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-2,18-dioxa-9,12-diazatricyclo[17.4.0.03,8]tricosa-1(23),3(8),4,6,19,21-hexaen-10-one |
| SMILES | COc1ccc(C(=O)N2CCCCCOc3ccccc3Oc3ccc(Cl)cc3NC(=O)C2)cc1CN(C)C |
| InChI | InChI=1S/C30H34ClN3O5/c1-33(2)19-22-17-21(11-13-25(22)37-3)30(36)34-15-7-4-8-16-38-27-9-5-6-10-28(27)39-26-14-12-23(31)18-24(26)32-29(35)20-34/h5-6,9-14,17-18H,4,7-8,15-16,19-20H2,1-3H3,(H,32,35) |
| InChIKey | WDFUJGUAHYXJRQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.07 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |