C28H34IN7O2 — CID 89429431
16-(iodomethyl)-18-oxa-1,7,11,13,22,26,33-heptazapentacyclo[24.2.2.23,6.214,17.18,12]pentatriaconta-3(35),4,6(34),8(33),9,11,14,16,31-nonaen-23-one (PubChem CID 89429431) has the molecular formula C28H34IN7O2 and a molecular weight of 627.53 g/mol. Its IUPAC name is 16-(iodomethyl)-18-oxa-1,7,11,13,22,26,33-heptazapentacyclo[24.2.2.23,6.214,17.18,12]pentatriaconta-3(35),4,6(34),8(33),9,11,14,16,31-nonaen-23-one.
| Compound Name | 16-(iodomethyl)-18-oxa-1,7,11,13,22,26,33-heptazapentacyclo[24.2.2.23,6.214,17.18,12]pentatriaconta-3(35),4,6(34),8(33),9,11,14,16,31-nonaen-23-one |
|---|---|
| PubChem CID | 89429431 |
| Molecular Formula | C28H34IN7O2 |
| Molecular Weight | 627.53 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | 16-(iodomethyl)-18-oxa-1,7,11,13,22,26,33-heptazapentacyclo[24.2.2.23,6.214,17.18,12]pentatriaconta-3(35),4,6(34),8(33),9,11,14,16,31-nonaen-23-one |
| SMILES | O=C1CCN2CCN(CC2)Cc2ccc(cc2)Nc2ccnc(n2)Nc2ccc(c(CI)c2)OCCCN1 |
| InChI | InChI=1S/C28H34IN7O2/c29-19-22-18-24-6-7-25(22)38-17-1-10-30-27(37)9-12-35-13-15-36(16-14-35)20-21-2-4-23(5-3-21)32-26-8-11-31-28(33-24)34-26/h2-8,11,18H,1,9-10,12-17,19-20H2,(H,30,37)(H2,31,32,33,34) |
| InChIKey | WUBPDEBDGVIOHD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|