C22H22N6O2 — CID 129142817
21-oxa-2,3,7,9,17,29-hexazapentacyclo[20.2.2.210,13.14,8.03,5]nonacosa-1(24),4(29),5,7,10(28),11,13(27),22,25-nonaen-18-one (PubChem CID 129142817) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 21-oxa-2,3,7,9,17,29-hexazapentacyclo[20.2.2.210,13.14,8.03,5]nonacosa-1(24),4(29),5,7,10(28),11,13(27),22,25-nonaen-18-one.
| Compound Name | 21-oxa-2,3,7,9,17,29-hexazapentacyclo[20.2.2.210,13.14,8.03,5]nonacosa-1(24),4(29),5,7,10(28),11,13(27),22,25-nonaen-18-one |
|---|---|
| PubChem CID | 129142817 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 21-oxa-2,3,7,9,17,29-hexazapentacyclo[20.2.2.210,13.14,8.03,5]nonacosa-1(24),4(29),5,7,10(28),11,13(27),22,25-nonaen-18-one |
| SMILES | O=C1CCOc2ccc(cc2)NN2c3cnc(nc32)Nc2ccc(cc2)CCCN1 |
| InChI | InChI=1S/C22H22N6O2/c29-20-11-13-30-18-9-7-17(8-10-18)27-28-19-14-24-22(26-21(19)28)25-16-5-3-15(4-6-16)2-1-12-23-20/h3-10,14,27H,1-2,11-13H2,(H,23,29)(H,24,25,26) |
| InChIKey | XACBRONRTBDRDW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|