C22H21N7O2 — CID 136630374
6-oxa-1,10,18,20,23,24,26-heptazapentacyclo[17.5.2.22,5.214,17.022,25]triaconta-2(30),3,5(29),14(28),15,17(27),19,21,23,25-decaen-9-one (PubChem CID 136630374) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 6-oxa-1,10,18,20,23,24,26-heptazapentacyclo[17.5.2.22,5.214,17.022,25]triaconta-2(30),3,5(29),14(28),15,17(27),19,21,23,25-decaen-9-one.
| Compound Name | 6-oxa-1,10,18,20,23,24,26-heptazapentacyclo[17.5.2.22,5.214,17.022,25]triaconta-2(30),3,5(29),14(28),15,17(27),19,21,23,25-decaen-9-one |
|---|---|
| PubChem CID | 136630374 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 6-oxa-1,10,18,20,23,24,26-heptazapentacyclo[17.5.2.22,5.214,17.022,25]triaconta-2(30),3,5(29),14(28),15,17(27),19,21,23,25-decaen-9-one |
| SMILES | O=C1CCOc2ccc(cc2)-n2nnc3cnc(nc32)Nc2ccc(cc2)CCCN1 |
| InChI | InChI=1S/C22H21N7O2/c30-20-11-13-31-18-9-7-17(8-10-18)29-21-19(27-28-29)14-24-22(26-21)25-16-5-3-15(4-6-16)2-1-12-23-20/h3-10,14H,1-2,11-13H2,(H,23,30)(H,24,25,26) |
| InChIKey | XIUPHCGTJWEDPM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |