C23H28N8O2 — CID 129142693
7-diazenyl-23-oxa-5,9,12,13,17,30-hexazatetracyclo[22.2.2.14,8.110,13]triaconta-1(27),4,6,8(30),10(29),11,24(28),25-octaen-18-one (PubChem CID 129142693) has the molecular formula C23H28N8O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 7-diazenyl-23-oxa-5,9,12,13,17,30-hexazatetracyclo[22.2.2.14,8.110,13]triaconta-1(27),4,6,8(30),10(29),11,24(28),25-octaen-18-one.
| Compound Name | 7-diazenyl-23-oxa-5,9,12,13,17,30-hexazatetracyclo[22.2.2.14,8.110,13]triaconta-1(27),4,6,8(30),10(29),11,24(28),25-octaen-18-one |
|---|---|
| PubChem CID | 129142693 |
| Molecular Formula | C23H28N8O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 7-diazenyl-23-oxa-5,9,12,13,17,30-hexazatetracyclo[22.2.2.14,8.110,13]triaconta-1(27),4,6,8(30),10(29),11,24(28),25-octaen-18-one |
| SMILES | [H]/N=N\c1cnc2nc1Nc1cnn(c1)CCCNC(=O)CCCCOc1ccc(cc1)CC2 |
| InChI | InChI=1S/C23H28N8O2/c24-30-20-15-26-21-10-7-17-5-8-19(9-6-17)33-13-2-1-4-22(32)25-11-3-12-31-16-18(14-27-31)28-23(20)29-21/h5-6,8-9,14-16,24H,1-4,7,10-13H2,(H,25,32)(H,26,28,29)/b30-24- |
| InChIKey | OFQITEVKSCLWDB-KRUMMXJUSA-N |
| XLogP | 3.93 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|